C13 H21 B N4 O4

Basic Information

MDL Number.: MFCD07375176
H bond acceptor: 8
H bond donor: 2
Smile: B(c1cnc(nc1)N2CCN(CC2)C(=O)OC(C)(C)C)(O)O
InChi: InChI=1S/C13H21BN4O4/c1-13(2,3)22-12(19)18-6-4-17(5-7-18)11-15-8-10(9-16-11)14(20)21/h8-9,20-21H,4-7H2,1-3H3