2,6-DIMETHYL-4(3H)-PYRIMIDINONE

pro_cas
6622-92-0
pro_cdbregno
CCD00597424
pro_formula
C6 H8 N2 O
pro_molWeight
124.142

basic_info

Product_Name: 2,6-DIMETHYL-4(3H)-PYRIMIDINONE
CAS: 6622-92-0
EnglishSynonyms: 2,6-DIMETHYLPYRIMIDIN-4(3H)-ONE ; 2,6-DIMETHYL-4(3H)-PYRIMIDINONE ; 4(3H)-PYRIMIDINONE, 2,6-DIMETHYL-
pro_mdlNumber: MFCD07656561
pro_acceptors: 3
pro_donors: 1
pro_smile: Cc1cc(=O)[nH]c(n1)C
InChi: InChI=1S/C6H8N2O/c1-4-3-6(9)8-5(2)7-4/h3H,1-2H3,(H,7,8,9)
InChiKey: InChIKey=UQFHLJKWYIJISA-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.