C10 H6 F2 N2 O3

Basic Information

CAS: 887267-57-4
MDL Number.: MFCD08458027
H bond acceptor: 5
H bond donor: 3
Smile: c1cc(c(cc1F)c2c([nH]c(=O)[nH]2)C(=O)O)F
InChi: InChI=1S/C10H6F2N2O3/c11-4-1-2-6(12)5(3-4)7-8(9(15)16)14-10(17)13-7/h1-3H,(H,15,16)(H2,13,14,17)