C13 H10 O5

Basic Information

CAS: 131-55-5
MDL Number.: MFCD08692012
H bond acceptor: 5
H bond donor: 4
Smile: c1cc(c(c(c1)O)C(=O)c2c(cccc2O)O)O
InChi: InChI=1S/C13H10O5/c14-7-3-1-4-8(15)11(7)13(18)12-9(16)5-2-6-10(12)17/h1-6,14-17H


Safety information