C5 H6 B F3 N2 O2

Basic Information

CAS: 344591-91-9
MDL Number.: MFCD08701785
H bond acceptor: 4
H bond donor: 2
Smile: B(c1cc(nn1C)C(F)(F)F)(O)O
InChi: InChI=1S/C5H6BF3N2O2/c1-11-4(6(12)13)2-3(10-11)5(7,8)9/h2,12-13H,1H3


Melting Point: 132-137 DEG C
WGK: 3

Safety information