1009307-13-4 ;1263187-14-9 ;1132669-74-9
C11 H19 B O4

Basic Information

CAS: 1009307-13-4 ;1263187-14-9 ;1132669-74-9
MDL Number.: MFCD09027313
H bond acceptor: 4
H bond donor: 0
Smile: B1(OC(C(O1)(C)C)(C)C)/C=C/C(=O)OCC
InChi: InChI=1S/C11H19BO4/c1-6-14-9(13)7-8-12-15-10(2,3)11(4,5)16-12/h7-8H,6H2,1-5H3/b8-7+



Safety information