C9 H9 F O

Basic Information

CAS: 175143-93-8
MDL Number.: MFCD09028588
H bond acceptor: 1
H bond donor: 0
Smile: c1ccc(c(c1)CCC=O)F
InChi: InChI=1S/C9H9FO/c10-9-6-2-1-4-8(9)5-3-7-11/h1-2,4,6-7H,3,5H2


Safety information