C7 H9 Cl N2

Basic Information

MDL Number.: MFCD10697161
H bond acceptor: 2
H bond donor: 0
Smile: CC(C)c1ncc(cn1)Cl
InChi: InChI=1S/C7H9ClN2/c1-5(2)7-9-3-6(8)4-10-7/h3-5H,1-2H3