2,6-DICHLOROBENZOTRIFLUORIDE

pro_cas
104359-35-5
pro_cdbregno
CCD00991942
pro_formula
C7 H3 Cl2 F3
pro_molWeight
215.001

basic_info

Product_Name: 2,6-DICHLOROBENZOTRIFLUORIDE
CAS: 104359-35-5
EnglishSynonyms: 2,6-DICHLORO BENZOTRIFLUORIDE ; 1,3-DICHLORO-2-(TRIFLUOROMETHYL)BENZENE ; 2,6-DICHLOROBENZOTRIFLUORIDE ; BENZENE, 1,3-DICHLORO-2-(TRIFLUOROMETHYL)-
pro_mdlNumber: MFCD11035870
pro_acceptors: 0
pro_donors: 0
pro_smile: c1cc(c(c(c1)Cl)C(F)(F)F)Cl
InChi: InChI=1S/C7H3Cl2F3/c8-4-2-1-3-5(9)6(4)7(10,11)12/h1-3H
InChiKey: InChIKey=MKSYCGMWKMMQPN-UHFFFAOYSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.