C10 H10 O

Basic Information

CAS: 21744-88-7
MDL Number.: MFCD11040232
H bond acceptor: 1
H bond donor: 0
Smile: c1ccc(cc1)C2(CC2)C=O
InChi: InChI=1S/C10H10O/c11-8-10(6-7-10)9-4-2-1-3-5-9/h1-5,8H,6-7H2