C6 H7 B F N O2

Basic Information

CAS: 929194-41-2
MDL Number.: MFCD11045052
H bond acceptor: 3
H bond donor: 2
Smile: B(c1cc(ncc1C)F)(O)O
InChi: InChI=1S/C6H7BFNO2/c1-4-3-9-6(8)2-5(4)7(10)11/h2-3,10-11H,1H3