C7 H10 N2

Basic Information

CAS: 50617-73-7
MDL Number.: MFCD11132708
H bond acceptor: 2
H bond donor: 2
Smile: CNc1cccc(c1)N
InChi: InChI=1S/C7H10N2/c1-9-7-4-2-3-6(8)5-7/h2-5,9H,8H2,1H3