C8 H10 Br N

Basic Information

CAS: 442910-30-7
MDL Number.: MFCD11617241
H bond acceptor: 1
H bond donor: 0
Smile: CCc1cccc(n1)CBr
InChi: InChI=1S/C8H10BrN/c1-2-7-4-3-5-8(6-9)10-7/h3-5H,2,6H2,1H3