C9 H12 Br N

Basic Information

CAS: 442910-39-6
MDL Number.: MFCD11617242
H bond acceptor: 1
H bond donor: 0
Smile: CCCc1cccc(n1)CBr
InChi: InChI=1S/C9H12BrN/c1-2-4-8-5-3-6-9(7-10)11-8/h3,5-6H,2,4,7H2,1H3