C9 H14 O4

Basic Information

CAS: 75338-17-9
MDL Number.: MFCD11974601
H bond acceptor: 4
H bond donor: 0
Smile: COC(=O)CC(=O)C1CCOCC1
InChi: InChI=1S/C9H14O4/c1-12-9(11)6-8(10)7-2-4-13-5-3-7/h7H,2-6H2,1H3