C7 H8 N2 O

Basic Information

CAS: 5661-01-8
MDL Number.: MFCD11977237
H bond acceptor: 3
H bond donor: 1
Smile: c1[nH]c2c(c(=O)n1)CCC2
InChi: InChI=1S/C7H8N2O/c10-7-5-2-1-3-6(5)8-4-9-7/h4H,1-3H2,(H,8,9,10)



Safety information