C7 H10 N4

Basic Information

CAS: 725202-85-7
MDL Number.: MFCD12024865
H bond acceptor: 4
H bond donor: 4
Smile: c1cc(cc(c1)NC(=N)N)N
InChi: InChI=1S/C7H10N4/c8-5-2-1-3-6(4-5)11-7(9)10/h1-4H,8H2,(H4,9,10,11)