C13 H12 O3

Basic Information

CAS: 75965-83-2
MDL Number.: MFCD12025110
H bond acceptor: 3
H bond donor: 0
Smile: COc1cc(c(c2c1cccc2)OC)C=O
InChi: InChI=1S/C13H12O3/c1-15-12-7-9(8-14)13(16-2)11-6-4-3-5-10(11)12/h3-8H,1-2H3