C8 H11 N O2 S

Basic Information

CAS: 76706-67-7
MDL Number.: MFCD12026865
H bond acceptor: 3
H bond donor: 0
Smile: CCc1nc(cs1)C(=O)OCC
InChi: InChI=1S/C8H11NO2S/c1-3-7-9-6(5-12-7)8(10)11-4-2/h5H,3-4H2,1-2H3



Safety information