C11 H13 N O2

Basic Information

CAS: 70875-53-5
MDL Number.: MFCD12091174
H bond acceptor: 3
H bond donor: 1
Smile: COc1ccc(cc1)CNC(=O)C=C
InChi: InChI=1S/C11H13NO2/c1-3-11(13)12-8-9-4-6-10(14-2)7-5-9/h3-7H,1,8H2,2H3,(H,12,13)