C5 H9 B N2 O2

Basic Information

CAS: 847818-68-2
MDL Number.: MFCD12407383
H bond acceptor: 4
H bond donor: 2
Smile: B(c1cc(nn1C)C)(O)O
InChi: InChI=1S/C5H9BN2O2/c1-4-3-5(6(9)10)8(2)7-4/h3,9-10H,1-2H3


Comments: ORIGINAL SKU: CDS007058-10MG

Safety information