C8 H6 B F3 O3

Basic Information

CAS: 1072944-24-1
MDL Number.: MFCD12761545
H bond acceptor: 3
H bond donor: 2
Smile: B(c1ccc(cc1C(F)(F)F)C=O)(O)O
InChi: InChI=1S/C8H6BF3O3/c10-8(11,12)6-3-5(4-13)1-2-7(6)9(14)15/h1-4,14-15H