C6 H3 Cl2 N3 S

Basic Information

CAS: 7464-11-1
MDL Number.: MFCD12828095
H bond acceptor: 3
H bond donor: 0
Smile: Cc1nc2c(s1)nc(nc2Cl)Cl
InChi: InChI=1S/C6H3Cl2N3S/c1-2-9-3-4(7)10-6(8)11-5(3)12-2/h1H3


Safety information