C7 H9 N O2

Basic Information

CAS: 28098-81-9
MDL Number.: MFCD12963977
H bond acceptor: 3
H bond donor: 1
Smile: C/C=C\1/C(C(=O)NC1=O)C
InChi: InChI=1S/C7H9NO2/c1-3-5-4(2)6(9)8-7(5)10/h3-4H,1-2H3,(H,8,9,10)/b5-3-