C8 H3 F N2 O S

Basic Information

CAS: 220050-44-2
MDL Number.: MFCD12964178
H bond acceptor: 3
H bond donor: 1
Smile: c1cc(c(c2c1nc(s2)C#N)F)O
InChi: InChI=1S/C8H3FN2OS/c9-7-5(12)2-1-4-8(7)13-6(3-10)11-4/h1-2,12H