C9 H8 Cl2 O

Basic Information

CAS: 4974-59-8
MDL Number.: MFCD13172989
H bond acceptor: 1
H bond donor: 0
Smile: Cc1ccc(cc1)C(=O)C(Cl)Cl
InChi: InChI=1S/C9H8Cl2O/c1-6-2-4-7(5-3-6)8(12)9(10)11/h2-5,9H,1H3