C6 H3 Cl F N O

Basic Information

CAS: 614752-51-1
MDL Number.: MFCD13189243
H bond acceptor: 2
H bond donor: 0
Smile: c1c(cc(nc1C=O)Cl)F
InChi: InChI=1S/C6H3ClFNO/c7-6-2-4(8)1-5(3-10)9-6/h1-3H