C11 H10 O3

Basic Information

CAS: 7517-83-1
MDL Number.: MFCD13191990
H bond acceptor: 3
H bond donor: 0
Smile: COc1ccccc1C#CC(=O)OC
InChi: InChI=1S/C11H10O3/c1-13-10-6-4-3-5-9(10)7-8-11(12)14-2/h3-6H,1-2H3