4705-43-5 ;768341-84-0
C9 H15 N O2

Basic Information

CAS: 4705-43-5 ;768341-84-0
MDL Number.: MFCD14584707
H bond acceptor: 3
H bond donor: 1
Smile: C1CCN(CC1)C/C=C/C(=O)O
InChi: InChI=1S/C9H15NO2/c11-9(12)5-4-8-10-6-2-1-3-7-10/h4-5H,1-3,6-8H2,(H,11,12)/b5-4+