C6 H3 F I N O2

Basic Information

CAS: 41860-64-4
MDL Number.: MFCD16658618
H bond acceptor: 3
H bond donor: 0
Smile: c1cc(c(cc1F)I)[N+](=O)[O-]
InChi: InChI=1S/C6H3FINO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H