C14 H14 O2

Basic Information

CAS: 15410-62-5
MDL Number.: MFCD16756789
H bond acceptor: 2
H bond donor: 1
Smile: CCC(c1cccc2c1cccc2)C(=O)O
InChi: InChI=1S/C14H14O2/c1-2-11(14(15)16)13-9-5-7-10-6-3-4-8-12(10)13/h3-9,11H,2H2,1H3,(H,15,16)