C12 H14 F2 O2

Basic Information

CAS: 1248685-13-3
MDL Number.: MFCD16756795
H bond acceptor: 2
H bond donor: 0
Smile: CC(C)C(c1cc(cc(c1)F)F)C(=O)OC
InChi: InChI=1S/C12H14F2O2/c1-7(2)11(12(15)16-3)8-4-9(13)6-10(14)5-8/h4-7,11H,1-3H3