C13 H17 F O2

Basic Information

CAS: 1250713-23-5
MDL Number.: MFCD16756807
H bond acceptor: 2
H bond donor: 0
Smile: CCC(c1cc(ccc1C)F)C(=O)OCC
InChi: InChI=1S/C13H17FO2/c1-4-11(13(15)16-5-2)12-8-10(14)7-6-9(12)3/h6-8,11H,4-5H2,1-3H3