C11 H11 F3 O2

Basic Information

CAS: 125670-61-3
MDL Number.: MFCD16756809
H bond acceptor: 2
H bond donor: 0
Smile: CC(c1ccc(cc1)C(F)(F)F)C(=O)OC
InChi: InChI=1S/C11H11F3O2/c1-7(10(15)16-2)8-3-5-9(6-4-8)11(12,13)14/h3-7H,1-2H3