C13 H18 O3

Basic Information

CAS: 149490-72-2
MDL Number.: MFCD16756827
H bond acceptor: 3
H bond donor: 0
Smile: CCC(c1cccc(c1)OC)C(=O)OCC
InChi: InChI=1S/C13H18O3/c1-4-12(13(14)16-5-2)10-7-6-8-11(9-10)15-3/h6-9,12H,4-5H2,1-3H3