7-ETHYL-5-(2-FLUORO-PHENYL)-8-METHYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE

pro_cas
pro_cdbregno
CCD03193321
pro_formula
C14 H13 F N4 O
pro_molWeight
272.282

basic_info

Product_Name: 7-ETHYL-5-(2-FLUORO-PHENYL)-8-METHYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
EnglishSynonyms: 7-ETHYL-5-(2-FLUORO-PHENYL)-8-METHYL-2H-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-ONE
pro_mdlNumber: MFCD16813229
pro_acceptors: 5
pro_donors: 1
pro_smile: CCc1c(c2n[nH]c(=O)n2c(n1)c3ccccc3F)C
InChi: InChI=1S/C14H13FN4O/c1-3-11-8(2)12-17-18-14(20)19(12)13(16-11)9-6-4-5-7-10(9)15/h4-7H,3H2,1-2H3,(H,18,20)
InChiKey: InChIKey=PJEPFFIFVYXIHF-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.