C9 H13 N3 O

Basic Information

CAS: 34999-37-6
MDL Number.: MFCD16837382
H bond acceptor: 4
H bond donor: 2
Smile: CNCCNC(=O)c1ccccn1
InChi: InChI=1S/C9H13N3O/c1-10-6-7-12-9(13)8-4-2-3-5-11-8/h2-5,10H,6-7H2,1H3,(H,12,13)