(2-CYCLOPROPYL-6-METHYLPYRIMIDIN-4-YL)METHANOL

pro_cas
pro_cdbregno
CCD03248038
pro_formula
C9 H12 N2 O
pro_molWeight
164.207

basic_info

Product_Name: (2-CYCLOPROPYL-6-METHYLPYRIMIDIN-4-YL)METHANOL
EnglishSynonyms: (2-CYCLOPROPYL-6-METHYLPYRIMIDIN-4-YL)METHANOL
pro_mdlNumber: MFCD16867968
pro_acceptors: 3
pro_donors: 1
pro_smile: Cc1cc(nc(n1)C2CC2)CO
InChi: InChI=1S/C9H12N2O/c1-6-4-8(5-12)11-9(10-6)7-2-3-7/h4,7,12H,2-3,5H2,1H3
InChiKey: InChIKey=PPUWCHOZLYAPTO-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.