C7 H13 N O2

Basic Information

CAS: 33545-50-5
MDL Number.: MFCD16872054
H bond acceptor: 3
H bond donor: 0
Smile: CCOC1CCC(=O)N1C
InChi: InChI=1S/C7H13NO2/c1-3-10-7-5-4-6(9)8(7)2/h7H,3-5H2,1-2H3