C14 H21 I

Basic Information

CAS: 37055-53-1
MDL Number.: MFCD16875483
H bond acceptor: 0
H bond donor: 0
Smile: CC(C)(C)c1cc(cc(c1)I)C(C)(C)C
InChi: InChI=1S/C14H21I/c1-13(2,3)10-7-11(14(4,5)6)9-12(15)8-10/h7-9H,1-6H3