C9 H9 F O4

Basic Information

CAS: 846046-30-8
MDL Number.: MFCD16877870
H bond acceptor: 4
H bond donor: 2
Smile: c1cc(c(cc1CO)F)OCC(=O)O
InChi: InChI=1S/C9H9FO4/c10-7-3-6(4-11)1-2-8(7)14-5-9(12)13/h1-3,11H,4-5H2,(H,12,13)