C8 H11 N3 O2

Basic Information

CAS: 856859-27-3
MDL Number.: MFCD16878188
H bond acceptor: 5
H bond donor: 2
Smile: CCOC(=O)Nc1cccc(n1)N
InChi: InChI=1S/C8H11N3O2/c1-2-13-8(12)11-7-5-3-4-6(9)10-7/h3-5H,2H2,1H3,(H3,9,10,11,12)