C7 H11 N3 O3

Basic Information

CAS: 861775-58-8
MDL Number.: MFCD16878498
H bond acceptor: 6
H bond donor: 3
Smile: CCOC(=O)NCc1c[nH]c(=O)[nH]1
InChi: InChI=1S/C7H11N3O3/c1-2-13-7(12)9-4-5-3-8-6(11)10-5/h3H,2,4H2,1H3,(H,9,12)(H2,8,10,11)