C23 H23 Br F N3

Basic Information

CAS: 1228095-73-5
MDL Number.: MFCD16883050
H bond acceptor: 3
H bond donor: 0
Smile: c1cc(ccc1/C=C/CN2CCN(CC2)Cc3ccc4cc(ccc4n3)F)Br
InChi: InChI=1S/C23H23BrFN3/c24-20-6-3-18(4-7-20)2-1-11-27-12-14-28(15-13-27)17-22-9-5-19-16-21(25)8-10-23(19)26-22/h1-10,16H,11-15,17H2/b2-1+