C10 H12 O3 S

Basic Information

CAS: 18333-20-5
MDL Number.: MFCD16883062
H bond acceptor: 3
H bond donor: 1
Smile: CSc1ccc(cc1)OCCC(=O)O
InChi: InChI=1S/C10H12O3S/c1-14-9-4-2-8(3-5-9)13-7-6-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)