C7 H3 Cl F4 O4 S2

Basic Information

CAS: 1027345-07-8
MDL Number.: MFCD16883063
H bond acceptor: 4
H bond donor: 0
Smile: c1cc(c(cc1S(=O)(=O)Cl)S(=O)(=O)C(F)(F)F)F
InChi: InChI=1S/C7H3ClF4O4S2/c8-18(15,16)4-1-2-5(9)6(3-4)17(13,14)7(10,11)12/h1-3H