C26 H21 Cl N2 O4

Basic Information

CAS: 1257849-07-2
MDL Number.: MFCD16883066
H bond acceptor: 6
H bond donor: 3
Smile: c1ccc2c(c1)-c3ccccc3C2COC(=O)N[C@@H](Cc4c[nH]c5c4cc(cc5)Cl)C(=O)O
InChi: InChI=1S/C26H21ClN2O4/c27-16-9-10-23-21(12-16)15(13-28-23)11-24(25(30)31)29-26(32)33-14-22-19-7-3-1-5-17(19)18-6-2-4-8-20(18)22/h1-10,12-13,22,24,28H,11,14H2,(H,29,32)(H,30,31)/t24-/m0/s1