C13 H23 N O4

Basic Information

CAS: 1140972-31-1
MDL Number.: MFCD16883075
H bond acceptor: 5
H bond donor: 1
Smile: CCOC(=O)[C@H]1CCC[C@H]1NC(=O)OC(C)(C)C
InChi: InChI=1S/C13H23NO4/c1-5-17-11(15)9-7-6-8-10(9)14-12(16)18-13(2,3)4/h9-10H,5-8H2,1-4H3,(H,14,16)/t9-,10+/m0/s1