C12 H18 N2

Basic Information

CAS: 1701-48-0
MDL Number.: MFCD16990807
H bond acceptor: 2
H bond donor: 1
Smile: CN(C)CC1CCc2ccccc2N1
InChi: InChI=1S/C12H18N2/c1-14(2)9-11-8-7-10-5-3-4-6-12(10)13-11/h3-6,11,13H,7-9H2,1-2H3