C12 H10 Cl N O3

Basic Information

CAS: 3356-95-4
MDL Number.: MFCD16991791
H bond acceptor: 4
H bond donor: 0
Smile: CCOC(=O)c1c(noc1Cl)c2ccccc2
InChi: InChI=1S/C12H10ClNO3/c1-2-16-12(15)9-10(14-17-11(9)13)8-6-4-3-5-7-8/h3-7H,2H2,1H3